C20H12Cl2FN3O — CID 121264422
N-[(4-chlorophenyl)-(6-chloro-3-pyridinyl)methyl]-4-cyano-3-fluorobenzamide (PubChem CID 121264422) has the molecular formula C20H12Cl2FN3O and a molecular weight of 400.24 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(6-chloro-3-pyridinyl)methyl]-4-cyano-3-fluorobenzamide.
| Compound Name | N-[(4-chlorophenyl)-(6-chloro-3-pyridinyl)methyl]-4-cyano-3-fluorobenzamide |
|---|---|
| PubChem CID | 121264422 |
| Molecular Formula | C20H12Cl2FN3O |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-[(4-chlorophenyl)-(6-chloro-3-pyridinyl)methyl]-4-cyano-3-fluorobenzamide |
| SMILES | N#Cc1ccc(C(=O)NC(c2ccc(Cl)cc2)c2ccc(Cl)nc2)cc1F |
| InChI | InChI=1S/C20H12Cl2FN3O/c21-16-6-3-12(4-7-16)19(15-5-8-18(22)25-11-15)26-20(27)13-1-2-14(10-24)17(23)9-13/h1-9,11,19H,(H,26,27) |
| InChIKey | NLBZNTDXJQXXJI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|