C22H15Cl2FN2O2 — CID 130293885
N-[(R)-(4-chloro-2-methoxyphenyl)-(4-chlorophenyl)methyl]-4-cyano-3-fluorobenzamide (PubChem CID 130293885) has the molecular formula C22H15Cl2FN2O2 and a molecular weight of 429.28 g/mol. Its IUPAC name is N-[(R)-(4-chloro-2-methoxyphenyl)-(4-chlorophenyl)methyl]-4-cyano-3-fluorobenzamide.
| Compound Name | N-[(R)-(4-chloro-2-methoxyphenyl)-(4-chlorophenyl)methyl]-4-cyano-3-fluorobenzamide |
|---|---|
| PubChem CID | 130293885 |
| Molecular Formula | C22H15Cl2FN2O2 |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | N-[(R)-(4-chloro-2-methoxyphenyl)-(4-chlorophenyl)methyl]-4-cyano-3-fluorobenzamide |
| SMILES | COc1cc(Cl)ccc1[C@H](NC(=O)c1ccc(C#N)c(F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15Cl2FN2O2/c1-29-20-11-17(24)8-9-18(20)21(13-4-6-16(23)7-5-13)27-22(28)14-2-3-15(12-26)19(25)10-14/h2-11,21H,1H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | WWFAYQYSFYVICP-OAQYLSRUSA-N |
| XLogP | 5.53 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |