C12H15ClN4O — CID 121272076
2-[(2-chloro-5-cyano-4-pyridinyl)amino]-N,N-dimethylbutanamide (PubChem CID 121272076) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 2-[(2-chloro-5-cyano-4-pyridinyl)amino]-N,N-dimethylbutanamide.
| Compound Name | 2-[(2-chloro-5-cyano-4-pyridinyl)amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 121272076 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[(2-chloro-5-cyano-4-pyridinyl)amino]-N,N-dimethylbutanamide |
| SMILES | CCC(Nc1cc(Cl)ncc1C#N)C(=O)N(C)C |
| InChI | InChI=1S/C12H15ClN4O/c1-4-9(12(18)17(2)3)16-10-5-11(13)15-7-8(10)6-14/h5,7,9H,4H2,1-3H3,(H,15,16) |
| InChIKey | BZZNWNFLOCIYAG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|