C15H14ClN3O2 — CID 162717535
methyl (1S,2S,3R,4R)-3-[(2-chloro-5-cyano-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 162717535) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is methyl (1S,2S,3R,4R)-3-[(2-chloro-5-cyano-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,3R,4R)-3-[(2-chloro-5-cyano-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 162717535 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl (1S,2S,3R,4R)-3-[(2-chloro-5-cyano-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](Nc2cc(Cl)ncc2C#N)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H14ClN3O2/c1-21-15(20)13-8-2-3-9(4-8)14(13)19-11-5-12(16)18-7-10(11)6-17/h2-3,5,7-9,13-14H,4H2,1H3,(H,18,19)/t8-,9+,13+,14-/m1/s1 |
| InChIKey | XGZURNBGQNCRGP-OBPYKSBLSA-N |
| XLogP | 2.38 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|