C27H32N8O — CID 162717536
(1S,2S,3R,4R)-3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-aminoanilino]-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 162717536) has the molecular formula C27H32N8O and a molecular weight of 484.61 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-aminoanilino]-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-aminoanilino]-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 162717536 |
| Molecular Formula | C27H32N8O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-aminoanilino]-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | N#Cc1cnc(Nc2ccc(N3CCN4CCCC4C3)cc2N)cc1N[C@H]1[C@@H](C(N)=O)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C27H32N8O/c28-13-18-14-31-24(12-23(18)33-26-17-4-3-16(10-17)25(26)27(30)36)32-22-6-5-19(11-21(22)29)35-9-8-34-7-1-2-20(34)15-35/h3-6,11-12,14,16-17,20,25-26H,1-2,7-10,15,29H2,(H2,30,36)(H2,31,32,33)/t16-,17+,20?,25+,26-/m1/s1 |
| InChIKey | FGXUJDAOPSLXCY-NSRFKPRKSA-N |
| XLogP | 2.65 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|