C24H27N7O2 — CID 162717551
(1S,2S,3R,4R)-3-[[2-(2-amino-4-morpholin-4-ylanilino)-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 162717551) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[2-(2-amino-4-morpholin-4-ylanilino)-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[2-(2-amino-4-morpholin-4-ylanilino)-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 162717551 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[2-(2-amino-4-morpholin-4-ylanilino)-5-cyano-4-pyridinyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | N#Cc1cnc(Nc2ccc(N3CCOCC3)cc2N)cc1N[C@H]1[C@@H](C(N)=O)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C24H27N7O2/c25-12-16-13-28-21(11-20(16)30-23-15-2-1-14(9-15)22(23)24(27)32)29-19-4-3-17(10-18(19)26)31-5-7-33-8-6-31/h1-4,10-11,13-15,22-23H,5-9,26H2,(H2,27,32)(H2,28,29,30)/t14-,15+,22+,23-/m1/s1 |
| InChIKey | CGBPWUBDLMYEIW-IEFMMKFASA-N |
| XLogP | 2.20 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|