C24H26ClN5O3 — CID 69090152
2-[[[5-chloro-2-(2-methoxy-4-morpholin-4-ylanilino)-4-pyridinyl]amino]methyl]benzamide (PubChem CID 69090152) has the molecular formula C24H26ClN5O3 and a molecular weight of 467.96 g/mol. Its IUPAC name is 2-[[[5-chloro-2-(2-methoxy-4-morpholin-4-ylanilino)-4-pyridinyl]amino]methyl]benzamide.
| Compound Name | 2-[[[5-chloro-2-(2-methoxy-4-morpholin-4-ylanilino)-4-pyridinyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 69090152 |
| Molecular Formula | C24H26ClN5O3 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[[[5-chloro-2-(2-methoxy-4-morpholin-4-ylanilino)-4-pyridinyl]amino]methyl]benzamide |
| SMILES | COc1cc(N2CCOCC2)ccc1Nc1cc(NCc2ccccc2C(N)=O)c(Cl)cn1 |
| InChI | InChI=1S/C24H26ClN5O3/c1-32-22-12-17(30-8-10-33-11-9-30)6-7-20(22)29-23-13-21(19(25)15-28-23)27-14-16-4-2-3-5-18(16)24(26)31/h2-7,12-13,15H,8-11,14H2,1H3,(H2,26,31)(H2,27,28,29) |
| InChIKey | HDQIDAHHGCHNFI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |