C17H17ClN6O — CID 90842896
2-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-pyridinyl]amino]methyl]benzamide (PubChem CID 90842896) has the molecular formula C17H17ClN6O and a molecular weight of 356.82 g/mol. Its IUPAC name is 2-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-pyridinyl]amino]methyl]benzamide.
| Compound Name | 2-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-pyridinyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 90842896 |
| Molecular Formula | C17H17ClN6O |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-4-pyridinyl]amino]methyl]benzamide |
| SMILES | Cn1cc(Nc2cc(NCc3ccccc3C(N)=O)c(Cl)cn2)cn1 |
| InChI | InChI=1S/C17H17ClN6O/c1-24-10-12(8-22-24)23-16-6-15(14(18)9-21-16)20-7-11-4-2-3-5-13(11)17(19)25/h2-6,8-10H,7H2,1H3,(H2,19,25)(H2,20,21,23) |
| InChIKey | UAAKXBACVGCFDO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |