C12H14N4O3 — CID 18548746
(2-amino-4-cyano-5-morpholin-4-ylphenyl)carbamic acid (PubChem CID 18548746) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is (2-amino-4-cyano-5-morpholin-4-ylphenyl)carbamic acid.
| Compound Name | (2-amino-4-cyano-5-morpholin-4-ylphenyl)carbamic acid |
|---|---|
| PubChem CID | 18548746 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2-amino-4-cyano-5-morpholin-4-ylphenyl)carbamic acid |
| SMILES | N#Cc1cc(N)c(NC(=O)O)cc1N1CCOCC1 |
| InChI | InChI=1S/C12H14N4O3/c13-7-8-5-9(14)10(15-12(17)18)6-11(8)16-1-3-19-4-2-16/h5-6,15H,1-4,14H2,(H,17,18) |
| InChIKey | UWABCDFNABVDNC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|