C22H24N8O — CID 171101655
5-[[1-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile (PubChem CID 171101655) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is 5-[[1-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[1-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 171101655 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 5-[[1-[4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-methoxyphenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile |
| SMILES | COc1cc(N2CCN3CCC[C@H]3C2)ccc1-n1cnc(Nc2cnc(C#N)cn2)c1 |
| InChI | InChI=1S/C22H24N8O/c1-31-20-9-17(29-8-7-28-6-2-3-18(28)13-29)4-5-19(20)30-14-22(26-15-30)27-21-12-24-16(10-23)11-25-21/h4-5,9,11-12,14-15,18H,2-3,6-8,13H2,1H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | SSFZCXWJHAQTNL-SFHVURJKSA-N |
| XLogP | 2.57 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |