C22H24N8 — CID 171101519
5-[[1-[4-[3-[(2R)-2-methylazetidin-1-yl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile (PubChem CID 171101519) has the molecular formula C22H24N8 and a molecular weight of 400.49 g/mol. Its IUPAC name is 5-[[1-[4-[3-[(2R)-2-methylazetidin-1-yl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[1-[4-[3-[(2R)-2-methylazetidin-1-yl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 171101519 |
| Molecular Formula | C22H24N8 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 5-[[1-[4-[3-[(2R)-2-methylazetidin-1-yl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile |
| SMILES | C[C@@H]1CCN1C1CCN(c2ccc(-n3cnc(Nc4cnc(C#N)cn4)c3)cc2)C1 |
| InChI | InChI=1S/C22H24N8/c1-16-6-9-30(16)20-7-8-28(13-20)18-2-4-19(5-3-18)29-14-22(26-15-29)27-21-12-24-17(10-23)11-25-21/h2-5,11-12,14-16,20H,6-9,13H2,1H3,(H,25,27)/t16-,20?/m1/s1 |
| InChIKey | QLPLEFLNJSFSMM-QRIPLOBPSA-N |
| XLogP | 2.95 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|