C21H24N8 — CID 171101829
5-[[1-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile (PubChem CID 171101829) has the molecular formula C21H24N8 and a molecular weight of 388.48 g/mol. Its IUPAC name is 5-[[1-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[1-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 171101829 |
| Molecular Formula | C21H24N8 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 5-[[1-[4-[3-[(dimethylamino)methyl]pyrrolidin-1-yl]phenyl]imidazol-4-yl]amino]pyrazine-2-carbonitrile |
| SMILES | CN(C)CC1CCN(c2ccc(-n3cnc(Nc4cnc(C#N)cn4)c3)cc2)C1 |
| InChI | InChI=1S/C21H24N8/c1-27(2)12-16-7-8-28(13-16)18-3-5-19(6-4-18)29-14-21(25-15-29)26-20-11-23-17(9-22)10-24-20/h3-6,10-11,14-16H,7-8,12-13H2,1-2H3,(H,24,26) |
| InChIKey | DGTQDXJIDPAJNC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|