C24H39NO2 — CID 121272833
(4S)-4-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-hydroxypentanamide (PubChem CID 121272833) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (4S)-4-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-hydroxypentanamide.
| Compound Name | (4S)-4-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-hydroxypentanamide |
|---|---|
| PubChem CID | 121272833 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (4S)-4-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-hydroxypentanamide |
| SMILES | C[C@H](C(O)CC(N)=O)[C@H]1CC[C@H]2[C@@H]3CCC4CC=CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H39NO2/c1-15(21(26)14-22(25)27)18-9-10-19-17-8-7-16-6-4-5-12-23(16,2)20(17)11-13-24(18,19)3/h4-5,15-21,26H,6-14H2,1-3H3,(H2,25,27)/t15-,16?,17-,18+,19-,20-,21?,23-,24+/m0/s1 |
| InChIKey | VPCFAHVXZKPJLD-TYXQHUSDSA-N |
| XLogP | 4.68 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|