C27H44O2 — CID 66900229
(2R,6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid (PubChem CID 66900229) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (2R,6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid.
| Compound Name | (2R,6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 66900229 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (2R,6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
| SMILES | C[C@H](CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC=CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)O |
| InChI | InChI=1S/C27H44O2/c1-18(8-7-9-19(2)25(28)29)22-13-14-23-21-12-11-20-10-5-6-16-26(20,3)24(21)15-17-27(22,23)4/h5-6,18-24H,7-17H2,1-4H3,(H,28,29)/t18-,19-,20?,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | RGYSGJRXYQMZPM-QSHXWOMUSA-N |
| XLogP | 7.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|