C31H29N5O5 — CID 121273567
4-[6-(but-2-ynoylamino)-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide (PubChem CID 121273567) has the molecular formula C31H29N5O5 and a molecular weight of 551.60 g/mol. Its IUPAC name is 4-[6-(but-2-ynoylamino)-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[6-(but-2-ynoylamino)-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 121273567 |
| Molecular Formula | C31H29N5O5 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 4-[6-(but-2-ynoylamino)-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide |
| SMILES | CC#CC(=O)Nc1cc2c(Oc3ccc(C(=O)Nc4ccccn4)cc3)ccnc2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C31H29N5O5/c1-2-5-30(37)34-26-20-24-25(21-28(26)40-19-16-36-14-17-39-18-15-36)32-13-11-27(24)41-23-9-7-22(8-10-23)31(38)35-29-6-3-4-12-33-29/h3-4,6-13,20-21H,14-19H2,1H3,(H,34,37)(H,33,35,38) |
| InChIKey | OPKHZFMFWCMAPS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|