C29H25N5O4 — CID 121280705
4-[6-(4-morpholin-4-ylbut-2-ynoylamino)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide (PubChem CID 121280705) has the molecular formula C29H25N5O4 and a molecular weight of 507.55 g/mol. Its IUPAC name is 4-[6-(4-morpholin-4-ylbut-2-ynoylamino)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[6-(4-morpholin-4-ylbut-2-ynoylamino)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 121280705 |
| Molecular Formula | C29H25N5O4 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 4-[6-(4-morpholin-4-ylbut-2-ynoylamino)quinolin-4-yl]oxy-N-pyridin-2-ylbenzamide |
| SMILES | O=C(C#CCN1CCOCC1)Nc1ccc2nccc(Oc3ccc(C(=O)Nc4ccccn4)cc3)c2c1 |
| InChI | InChI=1S/C29H25N5O4/c35-28(5-3-15-34-16-18-37-19-17-34)32-22-8-11-25-24(20-22)26(12-14-30-25)38-23-9-6-21(7-10-23)29(36)33-27-4-1-2-13-31-27/h1-2,4,6-14,20H,15-19H2,(H,32,35)(H,31,33,36) |
| InChIKey | MXXWRLXWERZYNI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|