C21H28N2O4S — CID 121273875
N-[2-[(5-benzyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)oxy]ethyl]propane-1-sulfonamide (PubChem CID 121273875) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is N-[2-[(5-benzyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)oxy]ethyl]propane-1-sulfonamide.
| Compound Name | N-[2-[(5-benzyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)oxy]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 121273875 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[2-[(5-benzyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)oxy]ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCOc1ccc2c(c1)C(Cc1ccccc1)NCCO2 |
| InChI | InChI=1S/C21H28N2O4S/c1-2-14-28(24,25)23-11-13-26-18-8-9-21-19(16-18)20(22-10-12-27-21)15-17-6-4-3-5-7-17/h3-9,16,20,22-23H,2,10-15H2,1H3 |
| InChIKey | PQGFSHSQNSLPLB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|