C9H12F6 — CID 121274265
1,1-diethyl-2,2-bis(trifluoromethyl)cyclopropane (PubChem CID 121274265) has the molecular formula C9H12F6 and a molecular weight of 234.18 g/mol. Its IUPAC name is 1,1-diethyl-2,2-bis(trifluoromethyl)cyclopropane.
| Compound Name | 1,1-diethyl-2,2-bis(trifluoromethyl)cyclopropane |
|---|---|
| PubChem CID | 121274265 |
| Molecular Formula | C9H12F6 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1,1-diethyl-2,2-bis(trifluoromethyl)cyclopropane |
| SMILES | CCC1(CC)CC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6/c1-3-6(4-2)5-7(6,8(10,11)12)9(13,14)15/h3-5H2,1-2H3 |
| InChIKey | HHXPEJKELRQYFJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |