C11H23FN2O2S — CID 121274615
N-[(1-butan-2-yl-4-fluoropyrrolidin-2-yl)methyl]-N-methylmethanesulfonamide (PubChem CID 121274615) has the molecular formula C11H23FN2O2S and a molecular weight of 266.38 g/mol. Its IUPAC name is N-[(1-butan-2-yl-4-fluoropyrrolidin-2-yl)methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[(1-butan-2-yl-4-fluoropyrrolidin-2-yl)methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 121274615 |
| Molecular Formula | C11H23FN2O2S |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-[(1-butan-2-yl-4-fluoropyrrolidin-2-yl)methyl]-N-methylmethanesulfonamide |
| SMILES | CCC(C)N1CC(F)CC1CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H23FN2O2S/c1-5-9(2)14-7-10(12)6-11(14)8-13(3)17(4,15)16/h9-11H,5-8H2,1-4H3 |
| InChIKey | XBCJGYBMLFHBHT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |