C26H29NO5 — CID 121277009
methyl (E)-4-methyl-6-[2-[[methyl-(2-methyl-1-benzofuran-5-carbonyl)amino]methyl]phenoxy]hex-4-enoate (PubChem CID 121277009) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is methyl (E)-4-methyl-6-[2-[[methyl-(2-methyl-1-benzofuran-5-carbonyl)amino]methyl]phenoxy]hex-4-enoate.
| Compound Name | methyl (E)-4-methyl-6-[2-[[methyl-(2-methyl-1-benzofuran-5-carbonyl)amino]methyl]phenoxy]hex-4-enoate |
|---|---|
| PubChem CID | 121277009 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | methyl (E)-4-methyl-6-[2-[[methyl-(2-methyl-1-benzofuran-5-carbonyl)amino]methyl]phenoxy]hex-4-enoate |
| SMILES | COC(=O)CC/C(C)=C/COc1ccccc1CN(C)C(=O)c1ccc2oc(C)cc2c1 |
| InChI | InChI=1S/C26H29NO5/c1-18(9-12-25(28)30-4)13-14-31-23-8-6-5-7-21(23)17-27(3)26(29)20-10-11-24-22(16-20)15-19(2)32-24/h5-8,10-11,13,15-16H,9,12,14,17H2,1-4H3/b18-13+ |
| InChIKey | URIIYYMTHVVWJO-QGOAFFKASA-N |
| XLogP | 5.29 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|