C28H31NO5 — CID 121277085
methyl (E)-4-methyl-6-[2-[[methyl-[4-(5-methylfuran-2-yl)benzoyl]amino]methyl]phenoxy]hex-4-enoate (PubChem CID 121277085) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl (E)-4-methyl-6-[2-[[methyl-[4-(5-methylfuran-2-yl)benzoyl]amino]methyl]phenoxy]hex-4-enoate.
| Compound Name | methyl (E)-4-methyl-6-[2-[[methyl-[4-(5-methylfuran-2-yl)benzoyl]amino]methyl]phenoxy]hex-4-enoate |
|---|---|
| PubChem CID | 121277085 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | methyl (E)-4-methyl-6-[2-[[methyl-[4-(5-methylfuran-2-yl)benzoyl]amino]methyl]phenoxy]hex-4-enoate |
| SMILES | COC(=O)CC/C(C)=C/COc1ccccc1CN(C)C(=O)c1ccc(-c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C28H31NO5/c1-20(9-16-27(30)32-4)17-18-33-25-8-6-5-7-24(25)19-29(3)28(31)23-13-11-22(12-14-23)26-15-10-21(2)34-26/h5-8,10-15,17H,9,16,18-19H2,1-4H3/b20-17+ |
| InChIKey | JXHMXRIISKKORG-LVZFUZTISA-N |
| XLogP | 5.81 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|