C21H28O3 — CID 121279067
1-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenyl]propan-1-ol (PubChem CID 121279067) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 1-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenyl]propan-1-ol.
| Compound Name | 1-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 121279067 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[4-[2-[4-(2-hydroxypropoxy)phenyl]propan-2-yl]phenyl]propan-1-ol |
| SMILES | CCC(O)c1ccc(C(C)(C)c2ccc(OCC(C)O)cc2)cc1 |
| InChI | InChI=1S/C21H28O3/c1-5-20(23)16-6-8-17(9-7-16)21(3,4)18-10-12-19(13-11-18)24-14-15(2)22/h6-13,15,20,22-23H,5,14H2,1-4H3 |
| InChIKey | JNFYZHWWLVGJIY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |