C18H17F2N — CID 121280949
2-[3-[(4,4-difluorocyclohexylidene)methyl]phenyl]pyridine (PubChem CID 121280949) has the molecular formula C18H17F2N and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[3-[(4,4-difluorocyclohexylidene)methyl]phenyl]pyridine.
| Compound Name | 2-[3-[(4,4-difluorocyclohexylidene)methyl]phenyl]pyridine |
|---|---|
| PubChem CID | 121280949 |
| Molecular Formula | C18H17F2N |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[3-[(4,4-difluorocyclohexylidene)methyl]phenyl]pyridine |
| SMILES | FC1(F)CCC(=Cc2cccc(-c3ccccn3)c2)CC1 |
| InChI | InChI=1S/C18H17F2N/c19-18(20)9-7-14(8-10-18)12-15-4-3-5-16(13-15)17-6-1-2-11-21-17/h1-6,11-13H,7-10H2 |
| InChIKey | YMQXPHDXLMIOFM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |