C18H18F3N3O5S — CID 121281408
carbonic acid;N-[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]cyclopentene-1-carboxamide (PubChem CID 121281408) has the molecular formula C18H18F3N3O5S and a molecular weight of 445.42 g/mol. Its IUPAC name is carbonic acid;N-[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]cyclopentene-1-carboxamide.
| Compound Name | carbonic acid;N-[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 121281408 |
| Molecular Formula | C18H18F3N3O5S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | carbonic acid;N-[3-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]cyclopentene-1-carboxamide |
| SMILES | O=C(Nc1sc2c(c1-c1nc(C(F)(F)F)no1)CCCC2)C1=CCCC1.O=C(O)O |
| InChI | InChI=1S/C17H16F3N3O2S.CH2O3/c18-17(19,20)16-22-14(25-23-16)12-10-7-3-4-8-11(10)26-15(12)21-13(24)9-5-1-2-6-9;2-1(3)4/h5H,1-4,6-8H2,(H,21,24);(H2,2,3,4) |
| InChIKey | IANXWIROVYKJHJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |