C19H21N3O7S2 — CID 121281279
carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]cyclopentene-1-carboxamide (PubChem CID 121281279) has the molecular formula C19H21N3O7S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]cyclopentene-1-carboxamide.
| Compound Name | carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 121281279 |
| Molecular Formula | C19H21N3O7S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]cyclopentene-1-carboxamide |
| SMILES | O=C(Nc1sc2c(c1-c1nc(C3CC3)no1)CCS(=O)(=O)C2)C1=CCCC1.O=C(O)O |
| InChI | InChI=1S/C18H19N3O4S2.CH2O3/c22-16(11-3-1-2-4-11)20-18-14(17-19-15(21-25-17)10-5-6-10)12-7-8-27(23,24)9-13(12)26-18;2-1(3)4/h3,10H,1-2,4-9H2,(H,20,22);(H2,2,3,4) |
| InChIKey | PBSMXFHXBBQJDP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |