C22H27N3O6S — CID 121281756
carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-yl]cyclopentene-1-carboxamide (PubChem CID 121281756) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-yl]cyclopentene-1-carboxamide.
| Compound Name | carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-yl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 121281756 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | carbonic acid;N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-yl]cyclopentene-1-carboxamide |
| SMILES | CC1(C)OC(C)(C)c2c1sc(NC(=O)C1=CCCC1)c2-c1nc(C2CC2)no1.O=C(O)O |
| InChI | InChI=1S/C21H25N3O3S.CH2O3/c1-20(2)14-13(18-22-16(24-26-18)11-9-10-11)19(28-15(14)21(3,4)27-20)23-17(25)12-7-5-6-8-12;2-1(3)4/h7,11H,5-6,8-10H2,1-4H3,(H,23,25);(H2,2,3,4) |
| InChIKey | PJBGFOMWHMLLIP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |