C15H19N3O2S — CID 118158662
3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-amine (PubChem CID 118158662) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-amine.
| Compound Name | 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-amine |
|---|---|
| PubChem CID | 118158662 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,4,6,6-tetramethylthieno[2,3-c]furan-2-amine |
| SMILES | CC1(C)OC(C)(C)c2c1sc(N)c2-c1nc(C2CC2)no1 |
| InChI | InChI=1S/C15H19N3O2S/c1-14(2)9-8(11(16)21-10(9)15(3,4)20-14)13-17-12(18-19-13)7-5-6-7/h7H,5-6,16H2,1-4H3 |
| InChIKey | PUPUUGHYRKEFLP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |