C20H33NO6 — CID 121282114
N,11,11-trihydroxy-N-(2-hydroxy-1-phenoxyethyl)dodecanamide (PubChem CID 121282114) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is N,11,11-trihydroxy-N-(2-hydroxy-1-phenoxyethyl)dodecanamide.
| Compound Name | N,11,11-trihydroxy-N-(2-hydroxy-1-phenoxyethyl)dodecanamide |
|---|---|
| PubChem CID | 121282114 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N,11,11-trihydroxy-N-(2-hydroxy-1-phenoxyethyl)dodecanamide |
| SMILES | CC(O)(O)CCCCCCCCCC(=O)N(O)C(CO)Oc1ccccc1 |
| InChI | InChI=1S/C20H33NO6/c1-20(24,25)15-11-6-4-2-3-5-10-14-18(23)21(26)19(16-22)27-17-12-8-7-9-13-17/h7-9,12-13,19,22,24-26H,2-6,10-11,14-16H2,1H3 |
| InChIKey | MIEZSJRYBXOQLK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|