C12H14N6O — CID 121282848
N-[2-(6-methyl-1,2,4,5-tetrazin-3-yl)-4-pyridinyl]butanamide (PubChem CID 121282848) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is N-[2-(6-methyl-1,2,4,5-tetrazin-3-yl)-4-pyridinyl]butanamide.
| Compound Name | N-[2-(6-methyl-1,2,4,5-tetrazin-3-yl)-4-pyridinyl]butanamide |
|---|---|
| PubChem CID | 121282848 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[2-(6-methyl-1,2,4,5-tetrazin-3-yl)-4-pyridinyl]butanamide |
| SMILES | CCCC(=O)Nc1ccnc(-c2nnc(C)nn2)c1 |
| InChI | InChI=1S/C12H14N6O/c1-3-4-11(19)14-9-5-6-13-10(7-9)12-17-15-8(2)16-18-12/h5-7H,3-4H2,1-2H3,(H,13,14,19) |
| InChIKey | UXGPQIQLVAKJJW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |