C30H25IN6O — CID 121282962
4-[5-iodo-1-[(4-methoxyphenyl)methyl]triazol-4-yl]-2-[1-(2-naphthalen-1-ylethyl)imidazol-4-yl]pyridine (PubChem CID 121282962) has the molecular formula C30H25IN6O and a molecular weight of 612.48 g/mol. Its IUPAC name is 4-[5-iodo-1-[(4-methoxyphenyl)methyl]triazol-4-yl]-2-[1-(2-naphthalen-1-ylethyl)imidazol-4-yl]pyridine.
| Compound Name | 4-[5-iodo-1-[(4-methoxyphenyl)methyl]triazol-4-yl]-2-[1-(2-naphthalen-1-ylethyl)imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 121282962 |
| Molecular Formula | C30H25IN6O |
| Molecular Weight | 612.48 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | 4-[5-iodo-1-[(4-methoxyphenyl)methyl]triazol-4-yl]-2-[1-(2-naphthalen-1-ylethyl)imidazol-4-yl]pyridine |
| SMILES | COc1ccc(Cn2nnc(-c3ccnc(-c4cn(CCc5cccc6ccccc56)cn4)c3)c2I)cc1 |
| InChI | InChI=1S/C30H25IN6O/c1-38-25-11-9-21(10-12-25)18-37-30(31)29(34-35-37)24-13-15-32-27(17-24)28-19-36(20-33-28)16-14-23-7-4-6-22-5-2-3-8-26(22)23/h2-13,15,17,19-20H,14,16,18H2,1H3 |
| InChIKey | MMOOBDAKJRQPGR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|