C20H21ClN6Si — CID 140710238
[5-[2-[1-[(2-chlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2H-triazol-4-yl]-trimethylsilane (PubChem CID 140710238) has the molecular formula C20H21ClN6Si and a molecular weight of 408.97 g/mol. Its IUPAC name is [5-[2-[1-[(2-chlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2H-triazol-4-yl]-trimethylsilane.
| Compound Name | [5-[2-[1-[(2-chlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2H-triazol-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 140710238 |
| Molecular Formula | C20H21ClN6Si |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [5-[2-[1-[(2-chlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2H-triazol-4-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1n[nH]nc1-c1ccnc(-c2cn(Cc3ccccc3Cl)cn2)c1 |
| InChI | InChI=1S/C20H21ClN6Si/c1-28(2,3)20-19(24-26-25-20)14-8-9-22-17(10-14)18-12-27(13-23-18)11-15-6-4-5-7-16(15)21/h4-10,12-13H,11H2,1-3H3,(H,24,25,26) |
| InChIKey | WNHKMCWLDXXPDE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|