C18H18Cl2N6 — CID 145046214
(Z)-1-[2-[1-[(2,3-dichlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2-hydrazinylprop-1-en-1-amine (PubChem CID 145046214) has the molecular formula C18H18Cl2N6 and a molecular weight of 389.29 g/mol. Its IUPAC name is (Z)-1-[2-[1-[(2,3-dichlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2-hydrazinylprop-1-en-1-amine.
| Compound Name | (Z)-1-[2-[1-[(2,3-dichlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2-hydrazinylprop-1-en-1-amine |
|---|---|
| PubChem CID | 145046214 |
| Molecular Formula | C18H18Cl2N6 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (Z)-1-[2-[1-[(2,3-dichlorophenyl)methyl]imidazol-4-yl]-4-pyridinyl]-2-hydrazinylprop-1-en-1-amine |
| SMILES | C/C(NN)=C(/N)c1ccnc(-c2cn(Cc3cccc(Cl)c3Cl)cn2)c1 |
| InChI | InChI=1S/C18H18Cl2N6/c1-11(25-22)18(21)12-5-6-23-15(7-12)16-9-26(10-24-16)8-13-3-2-4-14(19)17(13)20/h2-7,9-10,25H,8,21-22H2,1H3/b18-11- |
| InChIKey | LKHSTFMXUKGYFM-WQRHYEAKSA-N |
| XLogP | 3.41 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|