C19H17F5N6 — CID 130453065
(Z)-1-[2-[1-[2-(2,5-difluorophenyl)ethyl]imidazol-4-yl]-4-pyridinyl]-3,3,3-trifluoro-2-hydrazinylprop-1-en-1-amine (PubChem CID 130453065) has the molecular formula C19H17F5N6 and a molecular weight of 424.38 g/mol. Its IUPAC name is (Z)-1-[2-[1-[2-(2,5-difluorophenyl)ethyl]imidazol-4-yl]-4-pyridinyl]-3,3,3-trifluoro-2-hydrazinylprop-1-en-1-amine.
| Compound Name | (Z)-1-[2-[1-[2-(2,5-difluorophenyl)ethyl]imidazol-4-yl]-4-pyridinyl]-3,3,3-trifluoro-2-hydrazinylprop-1-en-1-amine |
|---|---|
| PubChem CID | 130453065 |
| Molecular Formula | C19H17F5N6 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (Z)-1-[2-[1-[2-(2,5-difluorophenyl)ethyl]imidazol-4-yl]-4-pyridinyl]-3,3,3-trifluoro-2-hydrazinylprop-1-en-1-amine |
| SMILES | NN/C(=C(\N)c1ccnc(-c2cn(CCc3cc(F)ccc3F)cn2)c1)C(F)(F)F |
| InChI | InChI=1S/C19H17F5N6/c20-13-1-2-14(21)11(7-13)4-6-30-9-16(28-10-30)15-8-12(3-5-27-15)17(25)18(29-26)19(22,23)24/h1-3,5,7-10,29H,4,6,25-26H2/b18-17- |
| InChIKey | PTTMFSGUXPMYCC-ZCXUNETKSA-N |
| XLogP | 3.12 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|