C20H18F3N5 — CID 123459408
N'-methyl-N-methylidene-2-[1-[2-[2-(trifluoromethyl)phenyl]ethyl]imidazol-4-yl]pyridine-4-carboximidamide (PubChem CID 123459408) has the molecular formula C20H18F3N5 and a molecular weight of 385.39 g/mol. Its IUPAC name is N'-methyl-N-methylidene-2-[1-[2-[2-(trifluoromethyl)phenyl]ethyl]imidazol-4-yl]pyridine-4-carboximidamide.
| Compound Name | N'-methyl-N-methylidene-2-[1-[2-[2-(trifluoromethyl)phenyl]ethyl]imidazol-4-yl]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 123459408 |
| Molecular Formula | C20H18F3N5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N'-methyl-N-methylidene-2-[1-[2-[2-(trifluoromethyl)phenyl]ethyl]imidazol-4-yl]pyridine-4-carboximidamide |
| SMILES | C=N/C(=N\C)c1ccnc(-c2cn(CCc3ccccc3C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C20H18F3N5/c1-24-19(25-2)15-7-9-26-17(11-15)18-12-28(13-27-18)10-8-14-5-3-4-6-16(14)20(21,22)23/h3-7,9,11-13H,1,8,10H2,2H3/b25-19- |
| InChIKey | BGYQFDHDWKUWBJ-PLRJNAJWSA-N |
| XLogP | 4.28 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|