C19H17F3N4O2 — CID 90457135
2-[2-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid (PubChem CID 90457135) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-[2-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 90457135 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[2-[2-[[2-(trifluoromethyl)phenyl]methylamino]ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2cnc(CCNCc3ccccc3C(F)(F)F)[nH]2)c1 |
| InChI | InChI=1S/C19H17F3N4O2/c20-19(21,22)14-4-2-1-3-13(14)10-23-7-6-17-25-11-16(26-17)15-9-12(18(27)28)5-8-24-15/h1-5,8-9,11,23H,6-7,10H2,(H,25,26)(H,27,28) |
| InChIKey | JQLFRUWVCBTXPP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|