C18H17ClN4O2 — CID 90457147
2-[2-[2-(2-chloro-N-methylanilino)ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid (PubChem CID 90457147) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-[2-[2-(2-chloro-N-methylanilino)ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-[2-(2-chloro-N-methylanilino)ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 90457147 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[2-[2-(2-chloro-N-methylanilino)ethyl]-1H-imidazol-5-yl]pyridine-4-carboxylic acid |
| SMILES | CN(CCc1ncc(-c2cc(C(=O)O)ccn2)[nH]1)c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN4O2/c1-23(16-5-3-2-4-13(16)19)9-7-17-21-11-15(22-17)14-10-12(18(24)25)6-8-20-14/h2-6,8,10-11H,7,9H2,1H3,(H,21,22)(H,24,25) |
| InChIKey | JJPNEVPJAZVYSD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |