C23H22N8 — CID 121283107
4-[6-(4-aminopiperidin-1-yl)-3-(1-methylbenzotriazol-5-yl)pyrazin-2-yl]benzonitrile (PubChem CID 121283107) has the molecular formula C23H22N8 and a molecular weight of 410.49 g/mol. Its IUPAC name is 4-[6-(4-aminopiperidin-1-yl)-3-(1-methylbenzotriazol-5-yl)pyrazin-2-yl]benzonitrile.
| Compound Name | 4-[6-(4-aminopiperidin-1-yl)-3-(1-methylbenzotriazol-5-yl)pyrazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 121283107 |
| Molecular Formula | C23H22N8 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-[6-(4-aminopiperidin-1-yl)-3-(1-methylbenzotriazol-5-yl)pyrazin-2-yl]benzonitrile |
| SMILES | Cn1nnc2cc(-c3ncc(N4CCC(N)CC4)nc3-c3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C23H22N8/c1-30-20-7-6-17(12-19(20)28-29-30)22-23(16-4-2-15(13-24)3-5-16)27-21(14-26-22)31-10-8-18(25)9-11-31/h2-7,12,14,18H,8-11,25H2,1H3 |
| InChIKey | OFVCUKWGQHNXFQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |