C25H25F2N3O4S — CID 121284279
2-[(3R,3aR,4S,5S,7aR)-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-6,6-difluoro-3,5-dimethyl-1,1-dioxo-2,3,3a,4,5,7-hexahydro-1,2-benzothiazol-7a-yl]acetic acid (PubChem CID 121284279) has the molecular formula C25H25F2N3O4S and a molecular weight of 501.56 g/mol. Its IUPAC name is 2-[(3R,3aR,4S,5S,7aR)-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-6,6-difluoro-3,5-dimethyl-1,1-dioxo-2,3,3a,4,5,7-hexahydro-1,2-benzothiazol-7a-yl]acetic acid.
| Compound Name | 2-[(3R,3aR,4S,5S,7aR)-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-6,6-difluoro-3,5-dimethyl-1,1-dioxo-2,3,3a,4,5,7-hexahydro-1,2-benzothiazol-7a-yl]acetic acid |
|---|---|
| PubChem CID | 121284279 |
| Molecular Formula | C25H25F2N3O4S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 2-[(3R,3aR,4S,5S,7aR)-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-6,6-difluoro-3,5-dimethyl-1,1-dioxo-2,3,3a,4,5,7-hexahydro-1,2-benzothiazol-7a-yl]acetic acid |
| SMILES | C[C@H]1NS(=O)(=O)[C@]2(CC(=O)O)CC(F)(F)[C@@H](C)[C@H](/C=C/c3ccc(-c4ccccc4C#N)cn3)[C@H]12 |
| InChI | InChI=1S/C25H25F2N3O4S/c1-15-20(10-9-19-8-7-18(13-29-19)21-6-4-3-5-17(21)12-28)23-16(2)30-35(33,34)24(23,11-22(31)32)14-25(15,26)27/h3-10,13,15-16,20,23,30H,11,14H2,1-2H3,(H,31,32)/b10-9+/t15-,16+,20-,23-,24+/m0/s1 |
| InChIKey | CVUIXNVBLACOTL-ASXUSFGFSA-N |
| XLogP | 4.08 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |