C47H49N4O2 — CID 59706668
CID 59706668 (PubChem CID 59706668) has the molecular formula C47H49N4O2 and a molecular weight of 701.94 g/mol.
| Compound Name | CID 59706668 |
|---|---|
| PubChem CID | 59706668 |
| Molecular Formula | C47H49N4O2 |
| Molecular Weight | 701.94 g/mol |
| Exact Mass | 701.39 |
| IUPAC Name | — |
| SMILES | CC1C(OC(=O)C[C@H]2[CH]C[C@H](C)[C@@H](C)[C@@H]2/C=C/c2ccc(-c3ccccc3C#N)cn2)C[C@H](C)[C@@H](C)[C@@H]1/C=C/c1ccc(-c2ccccc2C#N)cn1 |
| InChI | InChI=1S/C47H49N4O2/c1-30-14-15-35(43(32(30)3)23-21-41-19-17-39(29-51-41)45-13-9-7-11-37(45)27-49)25-47(52)53-46-24-31(2)33(4)42(34(46)5)22-20-40-18-16-38(28-50-40)44-12-8-6-10-36(44)26-48/h6-13,15-23,28-35,42-43,46H,14,24-25H2,1-5H3/b22-20+,23-21+/t30-,31-,32+,33+,34?,35+,42-,43-,46?/m0/s1 |
| InChIKey | VMGBOFMXTZKTKQ-VPWMESQJSA-N |
| XLogP | 10.62 |
| TPSA | 99.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.94 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |