C26H29N5O2 — CID 70990098
[(1R)-1-[(1S,2S,3R,4S,6S)-6-azido-2-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-3,4-dimethylcyclohexyl]ethyl] acetate (PubChem CID 70990098) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is [(1R)-1-[(1S,2S,3R,4S,6S)-6-azido-2-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-3,4-dimethylcyclohexyl]ethyl] acetate.
| Compound Name | [(1R)-1-[(1S,2S,3R,4S,6S)-6-azido-2-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-3,4-dimethylcyclohexyl]ethyl] acetate |
|---|---|
| PubChem CID | 70990098 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | [(1R)-1-[(1S,2S,3R,4S,6S)-6-azido-2-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-3,4-dimethylcyclohexyl]ethyl] acetate |
| SMILES | CC(=O)O[C@H](C)[C@H]1[C@@H](/C=C/c2ccc(-c3ccccc3C#N)cn2)[C@H](C)[C@@H](C)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C26H29N5O2/c1-16-13-25(30-31-28)26(18(3)33-19(4)32)23(17(16)2)12-11-22-10-9-21(15-29-22)24-8-6-5-7-20(24)14-27/h5-12,15-18,23,25-26H,13H2,1-4H3/b12-11+/t16-,17+,18+,23-,25-,26-/m0/s1 |
| InChIKey | YBWKNDFJHUFEJY-CYVIVSBYSA-N |
| XLogP | 6.17 |
| TPSA | 111.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|