C18H21N3O2 — CID 121284417
(E)-1-cyclohexyl-3-[5-(1H-imidazol-5-yl)-2-methoxy-4-pyridinyl]prop-2-en-1-one (PubChem CID 121284417) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (E)-1-cyclohexyl-3-[5-(1H-imidazol-5-yl)-2-methoxy-4-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-1-cyclohexyl-3-[5-(1H-imidazol-5-yl)-2-methoxy-4-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 121284417 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (E)-1-cyclohexyl-3-[5-(1H-imidazol-5-yl)-2-methoxy-4-pyridinyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)C2CCCCC2)c(-c2cnc[nH]2)cn1 |
| InChI | InChI=1S/C18H21N3O2/c1-23-18-9-14(15(10-20-18)16-11-19-12-21-16)7-8-17(22)13-5-3-2-4-6-13/h7-13H,2-6H2,1H3,(H,19,21)/b8-7+ |
| InChIKey | KLQHZUMHDFIRPK-BQYQJAHWSA-N |
| XLogP | 3.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|