C37H60O4 — CID 121284538
[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 121284538) has the molecular formula C37H60O4 and a molecular weight of 568.88 g/mol. Its IUPAC name is [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 121284538 |
| Molecular Formula | C37H60O4 |
| Molecular Weight | 568.88 g/mol |
| Exact Mass | 568.45 |
| IUPAC Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)OC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C37H60O4/c1-25(2)12-11-13-27(5)31-17-18-32-30-16-15-28-24-29(19-21-36(28,6)33(30)20-22-37(31,32)7)41-34(38)14-9-8-10-23-40-35(39)26(3)4/h15,25,27,29-33H,3,8-14,16-24H2,1-2,4-7H3/t27-,29?,30?,31-,32?,33?,36+,37-/m1/s1 |
| InChIKey | YTCXMXAHRBWKIS-BBHHCFGSSA-N |
| XLogP | 9.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.88 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|