C24H30N2O4 — CID 121285146
2-[2-(4-ethylpiperazine-1-carbonyl)hex-1-enyl]-3-methoxynaphthalene-1,4-dione (PubChem CID 121285146) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[2-(4-ethylpiperazine-1-carbonyl)hex-1-enyl]-3-methoxynaphthalene-1,4-dione.
| Compound Name | 2-[2-(4-ethylpiperazine-1-carbonyl)hex-1-enyl]-3-methoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 121285146 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-[2-(4-ethylpiperazine-1-carbonyl)hex-1-enyl]-3-methoxynaphthalene-1,4-dione |
| SMILES | CCCCC(=CC1=C(OC)C(=O)c2ccccc2C1=O)C(=O)N1CCN(CC)CC1 |
| InChI | InChI=1S/C24H30N2O4/c1-4-6-9-17(24(29)26-14-12-25(5-2)13-15-26)16-20-21(27)18-10-7-8-11-19(18)22(28)23(20)30-3/h7-8,10-11,16H,4-6,9,12-15H2,1-3H3 |
| InChIKey | ARLWZBQNVCLZQK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|