C16H17NO3 — CID 936438
2-methoxy-3-piperidin-1-ylnaphthalene-1,4-dione (PubChem CID 936438) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-methoxy-3-piperidin-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-methoxy-3-piperidin-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 936438 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-methoxy-3-piperidin-1-ylnaphthalene-1,4-dione |
| SMILES | COC1=C(N2CCCCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H17NO3/c1-20-16-13(17-9-5-2-6-10-17)14(18)11-7-3-4-8-12(11)15(16)19/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | WESRTHUHTPUNDI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|