C24H36O4 — CID 121285151
2-[2-(2-methoxypropanoyl)undec-1-enyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 121285151) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[2-(2-methoxypropanoyl)undec-1-enyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[2-(2-methoxypropanoyl)undec-1-enyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 121285151 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[2-(2-methoxypropanoyl)undec-1-enyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCCCC(=CC1=C(C)C(=O)C(C)=C(C)C1=O)C(=O)C(C)OC |
| InChI | InChI=1S/C24H36O4/c1-7-8-9-10-11-12-13-14-20(24(27)19(5)28-6)15-21-18(4)22(25)16(2)17(3)23(21)26/h15,19H,7-14H2,1-6H3 |
| InChIKey | PZDNDRIUXSLYGO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|