C38H22N8 — CID 121287279
3-[4-[7-(4-quinolin-3-yl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]quinoline (PubChem CID 121287279) has the molecular formula C38H22N8 and a molecular weight of 590.65 g/mol. Its IUPAC name is 3-[4-[7-(4-quinolin-3-yl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]quinoline.
| Compound Name | 3-[4-[7-(4-quinolin-3-yl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]quinoline |
|---|---|
| PubChem CID | 121287279 |
| Molecular Formula | C38H22N8 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 3-[4-[7-(4-quinolin-3-yl-1,3,5-triazin-2-yl)phenanthren-2-yl]-1,3,5-triazin-2-yl]quinoline |
| SMILES | c1ccc2ncc(-c3ncnc(-c4ccc5c(ccc6cc(-c7ncnc(-c8cnc9ccccc9c8)n7)ccc65)c4)n3)cc2c1 |
| InChI | InChI=1S/C38H22N8/c1-3-7-33-25(5-1)17-29(19-39-33)37-43-21-41-35(45-37)27-11-13-31-23(15-27)9-10-24-16-28(12-14-32(24)31)36-42-22-44-38(46-36)30-18-26-6-2-4-8-34(26)40-20-30/h1-22H |
| InChIKey | RCYXZXCTDCPMIK-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|