C16H10ClN5O2S — CID 121290391
2-(2-chloro-4-pyridinyl)-5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 121290391) has the molecular formula C16H10ClN5O2S and a molecular weight of 371.81 g/mol. Its IUPAC name is 2-(2-chloro-4-pyridinyl)-5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloro-4-pyridinyl)-5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 121290391 |
| Molecular Formula | C16H10ClN5O2S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 2-(2-chloro-4-pyridinyl)-5-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Clc1cc(-c2nnc(SCc3nc(-c4ccccc4)no3)o2)ccn1 |
| InChI | InChI=1S/C16H10ClN5O2S/c17-12-8-11(6-7-18-12)15-20-21-16(23-15)25-9-13-19-14(22-24-13)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | MRPTVUXBJGOVPZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|