C16H10N6O4S — CID 121290405
3-(2-nitrophenyl)-5-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 121290405) has the molecular formula C16H10N6O4S and a molecular weight of 382.36 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-5-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(2-nitrophenyl)-5-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 121290405 |
| Molecular Formula | C16H10N6O4S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-(2-nitrophenyl)-5-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1noc(CSc2nnc(-c3ccncc3)o2)n1 |
| InChI | InChI=1S/C16H10N6O4S/c23-22(24)12-4-2-1-3-11(12)14-18-13(26-21-14)9-27-16-20-19-15(25-16)10-5-7-17-8-6-10/h1-8H,9H2 |
| InChIKey | JHOJOIQKMVROOQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 133.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|