C8H13NO — CID 121293249
2-ethenyl-5-propyl-4,5-dihydro-1,3-oxazole (PubChem CID 121293249) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-ethenyl-5-propyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-ethenyl-5-propyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 121293249 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-ethenyl-5-propyl-4,5-dihydro-1,3-oxazole |
| SMILES | C=CC1=NCC(CCC)O1 |
| InChI | InChI=1S/C8H13NO/c1-3-5-7-6-9-8(4-2)10-7/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | RPSJOLSVLHFYOU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |