C9H14O — CID 142713052
3-ethenyl-2-propyl-2,5-dihydrofuran (PubChem CID 142713052) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-ethenyl-2-propyl-2,5-dihydrofuran.
| Compound Name | 3-ethenyl-2-propyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 142713052 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 3-ethenyl-2-propyl-2,5-dihydrofuran |
| SMILES | C=CC1=CCOC1CCC |
| InChI | InChI=1S/C9H14O/c1-3-5-9-8(4-2)6-7-10-9/h4,6,9H,2-3,5,7H2,1H3 |
| InChIKey | WGSGADUYCTUDTA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |